CAS 56181-65-8 is the registry number for Difenacoum Related Compound 4. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-phenylphenyl)-3,4-dihydro-2H-naphthalen-1-one (CAS 56181-65-8) is a chemical compound with the molecular formula C22H18O and a molecular weight of 298.4 g/mol. IUPAC name: 3-(4-phenylphenyl)-3,4-dihydro-2H-naphthalen-1-one. InChIKey: AFIAHUCZUURHQW-UHFFFAOYSA-N.
| Molecular formula | C22H18O |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 3-(4-phenylphenyl)-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | AFIAHUCZUURHQW-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)C2=CC=CC=C21)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)