Products 1027408-37-2

CAS 1027408-37-2 is the registry number for tert-Butyl N-(4-aminobutyl)-N-(benzyloxy)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(4-aminobutyl)-N-phenylmethoxycarbamate (CAS 1027408-37-2) is a chemical compound with the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. IUPAC name: tert-butyl N-(4-aminobutyl)-N-phenylmethoxycarbamate. InChIKey: PRQRBTJLFIMWLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H26N2O3
Molecular weight294.39 g/mol
IUPAC nametert-butyl N-(4-aminobutyl)-N-phenylmethoxycarbamate
InChIKeyPRQRBTJLFIMWLJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(CCCCN)OCC1=CC=CC=C1

Computed by PubChem (NCBI)