CAS 1808568-99-1 is the registry number for Ethyl N-((1S,2R)-2-(aminomethyl)-1-(4-methoxyphenyl)-3-methylbutyl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl N-[(1S,2R)-2-(aminomethyl)-1-(4-methoxyphenyl)-3-methylbutyl]carbamate (CAS 1808568-99-1) is a chemical compound with the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. IUPAC name: ethyl N-[(1S,2R)-2-(aminomethyl)-1-(4-methoxyphenyl)-3-methylbutyl]carbamate. InChIKey: YLBOQGDTUYPDGE-LSDHHAIUSA-N.
| Molecular formula | C16H26N2O3 |
|---|---|
| Molecular weight | 294.39 g/mol |
| IUPAC name | ethyl N-[(1S,2R)-2-(aminomethyl)-1-(4-methoxyphenyl)-3-methylbutyl]carbamate |
| InChIKey | YLBOQGDTUYPDGE-LSDHHAIUSA-N |
| SMILES | CCOC(=O)N[C@H](C1=CC=C(C=C1)OC)[C@@H](CN)C(C)C |
Computed by PubChem (NCBI)