CAS 1027512-27-1 appears in our catalog under these names: 2-Chloro-3,5-dibromobenzotrifluoride, 98%, 2–Chloro–3,5–dibromobenzotrifluoride, 2-Chloro-3,5-dibromobenzotrifluoride 97%, 1,5-dibromo-2-chloro-3-(trifluoromethyl)benzene, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
1,5-dibromo-2-chloro-3-(trifluoromethyl)benzene (CAS 1027512-27-1) is a chemical compound with the molecular formula C7H2Br2ClF3 and a molecular weight of 338.34 g/mol. IUPAC name: 1,5-dibromo-2-chloro-3-(trifluoromethyl)benzene. InChIKey: YPISBIZKLWHNPX-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2ClF3 |
|---|---|
| Molecular weight | 338.34 g/mol |
| IUPAC name | 1,5-dibromo-2-chloro-3-(trifluoromethyl)benzene |
| InChIKey | YPISBIZKLWHNPX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Br)Br |
Computed by PubChem (NCBI)