CAS 1027512-84-0 appears in our catalog under these names: 2,3-Dibromo-5-chlorobenzotrifluoride, 95%, 2,3-Dibromo-5-chlorobenzotrifluoride, 98%, 2,3-Dibromo-5-chlorobenzotrifluoride, ≥95%, ≥95%, 2,3-Dibromo-5-chlorobenzotrifluoride. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1,2-dibromo-5-chloro-3-(trifluoromethyl)benzene (CAS 1027512-84-0) is a chemical compound with the molecular formula C7H2Br2ClF3 and a molecular weight of 338.34 g/mol. IUPAC name: 1,2-dibromo-5-chloro-3-(trifluoromethyl)benzene. InChIKey: XHKRVDKJBRJYHA-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2ClF3 |
|---|---|
| Molecular weight | 338.34 g/mol |
| IUPAC name | 1,2-dibromo-5-chloro-3-(trifluoromethyl)benzene |
| InChIKey | XHKRVDKJBRJYHA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Br)Br)Cl |
Computed by PubChem (NCBI)