CAS 1027512-45-3 is the registry number for 4-Bromo-4'-ethyl-3-fluoro-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-4-(4-ethylphenyl)-2-fluorobenzene (CAS 1027512-45-3) is a chemical compound with the molecular formula C14H12BrF and a molecular weight of 279.15 g/mol. IUPAC name: 1-bromo-4-(4-ethylphenyl)-2-fluorobenzene. InChIKey: PHQBFZFUJIGZRC-UHFFFAOYSA-N.
| Molecular formula | C14H12BrF |
|---|---|
| Molecular weight | 279.15 g/mol |
| IUPAC name | 1-bromo-4-(4-ethylphenyl)-2-fluorobenzene |
| InChIKey | PHQBFZFUJIGZRC-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)