CAS 1776111-97-7 is the registry number for 4-Bromo-1-fluoro-2-(4-methylbenzyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-bromo-1-fluoro-2-[(4-methylphenyl)methyl]benzene (CAS 1776111-97-7) is a chemical compound with the molecular formula C14H12BrF and a molecular weight of 279.15 g/mol. IUPAC name: 4-bromo-1-fluoro-2-[(4-methylphenyl)methyl]benzene. InChIKey: HLCAETGCFLRPTF-UHFFFAOYSA-N.
| Molecular formula | C14H12BrF |
|---|---|
| Molecular weight | 279.15 g/mol |
| IUPAC name | 4-bromo-1-fluoro-2-[(4-methylphenyl)methyl]benzene |
| InChIKey | HLCAETGCFLRPTF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)