CAS 1027512-75-9 appears in our catalog under these names: 3-Bromo-5-chloro-2-iodobenzotrifluoride, 95%, 1-Bromo-5-chloro-2-iodo-3-(trifluoromethyl)benzene, 97%, 3-Bromo-5-chloro-2-iodobenzotrifluoride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
1-bromo-5-chloro-2-iodo-3-(trifluoromethyl)benzene (CAS 1027512-75-9) is a chemical compound with the molecular formula C7H2BrClF3I and a molecular weight of 385.35 g/mol. IUPAC name: 1-bromo-5-chloro-2-iodo-3-(trifluoromethyl)benzene. InChIKey: JKVQTPJJSMFCCZ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF3I |
|---|---|
| Molecular weight | 385.35 g/mol |
| IUPAC name | 1-bromo-5-chloro-2-iodo-3-(trifluoromethyl)benzene |
| InChIKey | JKVQTPJJSMFCCZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)I)Br)Cl |
Computed by PubChem (NCBI)