Products 2383999-91-3
CAS 2383999-91-3 is the registry number for 1-bromo-4-chloro-5-iodo-2-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-4-chloro-5-iodo-2-(trifluoromethyl)benzene (CAS 2383999-91-3) is a chemical compound with the molecular formula C7H2BrClF3I and a molecular weight of 385.35 g/mol. IUPAC name: 1-bromo-4-chloro-5-iodo-2-(trifluoromethyl)benzene. InChIKey: ZLVCALJRCGXQQY-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF3I |
|---|---|
| Molecular weight | 385.35 g/mol |
| IUPAC name | 1-bromo-4-chloro-5-iodo-2-(trifluoromethyl)benzene |
| InChIKey | ZLVCALJRCGXQQY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)I)Br)C(F)(F)F |
Computed by PubChem (NCBI)