Products 1027513-10-5
CAS 1027513-10-5 is the registry number for 3-Fluoro-5-(trifluoromethyl)phenylisothiocyanate, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
1-fluoro-3-isothiocyanato-5-(trifluoromethyl)benzene (CAS 1027513-10-5) is a chemical compound with the molecular formula C8H3F4NS and a molecular weight of 221.18 g/mol. IUPAC name: 1-fluoro-3-isothiocyanato-5-(trifluoromethyl)benzene. InChIKey: JVRZULHQGCMNER-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NS |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 1-fluoro-3-isothiocyanato-5-(trifluoromethyl)benzene |
| InChIKey | JVRZULHQGCMNER-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N=C=S)F)C(F)(F)F |
Computed by PubChem (NCBI)