Products 102754-41-6

CAS 102754-41-6 is the registry number for N,5-Dibenzyl-5-hydroxy-indole-3-glyoxylamide. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 250mg, 100mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

N-benzyl-2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetamide (CAS 102754-41-6) is a chemical compound with the molecular formula C24H20N2O3 and a molecular weight of 384.4 g/mol. IUPAC name: N-benzyl-2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetamide. InChIKey: SNEFRISDFLQEDB-UHFFFAOYSA-N.

Identity
Molecular formulaC24H20N2O3
Molecular weight384.4 g/mol
IUPAC nameN-benzyl-2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetamide
InChIKeySNEFRISDFLQEDB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CNC(=O)C(=O)C2=CNC3=C2C=C(C=C3)OCC4=CC=CC=C4

Computed by PubChem (NCBI)