Products 13080-88-1
CAS 13080-88-1 is the registry number for 4-(4-(4-(4-aMinophenoxy)phenoxy)phenoxy)benzenaMine. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
4-[4-[4-(4-aminophenoxy)phenoxy]phenoxy]aniline (CAS 13080-88-1) is a chemical compound with the molecular formula C24H20N2O3 and a molecular weight of 384.4 g/mol. IUPAC name: 4-[4-[4-(4-aminophenoxy)phenoxy]phenoxy]aniline. InChIKey: LDFYRFKAYFZVNH-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O3 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 4-[4-[4-(4-aminophenoxy)phenoxy]phenoxy]aniline |
| InChIKey | LDFYRFKAYFZVNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC=C(C=C2)OC3=CC=C(C=C3)OC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)