Products 10276-85-4
CAS 10276-85-4 appears in our catalog under these names: Benzyl octanoate, 95%, Benzyl Octanoate, >95.0%(GC), Benzyl caprylate, Benzyl octanoate 98%, Benzyl Octanoate, 98%, 98%. Offered by: Combi-blocks, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 50g, 100g, 500g, 250g.
Benzyl octanoate (CAS 10276-85-4) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: benzyl octanoate. InChIKey: MWQWCHLIPMDVLS-UHFFFAOYSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | benzyl octanoate |
| InChIKey | MWQWCHLIPMDVLS-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)