Products 1027709-85-8
CAS 1027709-85-8 appears in our catalog under these names: (R)-1-(Benzo(b)thiophen-3-yl)ethanamine hydrochloride, 95%, (R)-1-(Benzo(b)thiophen-3-yl)ethanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1R)-1-(1-benzothiophen-3-yl)ethanamine;hydrochloride (CAS 1027709-85-8) is a chemical compound with the molecular formula C10H12ClNS and a molecular weight of 213.73 g/mol. IUPAC name: (1R)-1-(1-benzothiophen-3-yl)ethanamine;hydrochloride. InChIKey: HBQPIEGNXUZBDW-OGFXRTJISA-N.
| Molecular formula | C10H12ClNS |
|---|---|
| Molecular weight | 213.73 g/mol |
| IUPAC name | (1R)-1-(1-benzothiophen-3-yl)ethanamine;hydrochloride |
| InChIKey | HBQPIEGNXUZBDW-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CSC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)