CAS 117234-06-7 appears in our catalog under these names: 1-(1-Benzothiophen-3-yl)ethan-1-amine hydrochloride, 1-(1-BENZOTHIOPHEN-3-YL)ETHAN-1-AMINE HYDROCHLORIDE, 97%, 97%, 1-(Benzo[b]thiophen-3-yl)ethan-1-amine hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg.
1-(1-benzothiophen-3-yl)ethanamine;hydrochloride (CAS 117234-06-7) is a chemical compound with the molecular formula C10H12ClNS and a molecular weight of 213.73 g/mol. IUPAC name: 1-(1-benzothiophen-3-yl)ethanamine;hydrochloride. InChIKey: HBQPIEGNXUZBDW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNS |
|---|---|
| Molecular weight | 213.73 g/mol |
| IUPAC name | 1-(1-benzothiophen-3-yl)ethanamine;hydrochloride |
| InChIKey | HBQPIEGNXUZBDW-UHFFFAOYSA-N |
| SMILES | CC(C1=CSC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)