CAS 1027710-05-9 appears in our catalog under these names: Cis-1-tert-butyl 4-ethyl 3-phenylpiperidine-1,4-dicarboxylate, 95%, Ethyl cis-N-Boc-3-phenylpiperidine-4-carboxylate, 95+%, Ethyl cis–N–Boc–3–phenylpiperidine–4–carboxylate, rel-(3R,4S)-1-(tert-Butoxycarbonyl)-3-phenylpiperidine-4-carboxylic acid ethyl ester, 95+%, 95+%, 1-O-tert-Butyl 4-O-ethyl (3R,4S)-3-phenylpiperidine-1,4-dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
1-O-tert-butyl 4-O-ethyl (3R,4S)-3-phenylpiperidine-1,4-dicarboxylate (CAS 1027710-05-9) is a chemical compound with the molecular formula C19H27NO4 and a molecular weight of 333.4 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl (3R,4S)-3-phenylpiperidine-1,4-dicarboxylate. InChIKey: RUKNPFBJQDRKIS-HOTGVXAUSA-N.
| Molecular formula | C19H27NO4 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl (3R,4S)-3-phenylpiperidine-1,4-dicarboxylate |
| InChIKey | RUKNPFBJQDRKIS-HOTGVXAUSA-N |
| SMILES | CCOC(=O)[C@H]1CCN(C[C@H]1C2=CC=CC=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)