CAS 170947-82-7 appears in our catalog under these names: (2S,4S)-1-Boc-4-benzylpyrrolidine-2-dicarboxylic acid ethyl ester, 95%, (2S,4S)-1-tert-Butyl 2-ethyl 4-benzylpyrrolidine-1,2-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1-O-tert-butyl 2-O-ethyl (2S,4S)-4-benzylpyrrolidine-1,2-dicarboxylate (CAS 170947-82-7) is a chemical compound with the molecular formula C19H27NO4 and a molecular weight of 333.4 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S,4S)-4-benzylpyrrolidine-1,2-dicarboxylate. InChIKey: IVCWKVZFUSQDJR-HOTGVXAUSA-N.
| Molecular formula | C19H27NO4 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S,4S)-4-benzylpyrrolidine-1,2-dicarboxylate |
| InChIKey | IVCWKVZFUSQDJR-HOTGVXAUSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](CN1C(=O)OC(C)(C)C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)