CAS 1027915-16-7 appears in our catalog under these names: 6-Bromo-4,4-dimethylchroman, 95%, 6-Bromo-4,4-dimethyl-chroman. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 5g.
6-bromo-4,4-dimethyl-2,3-dihydrochromene (CAS 1027915-16-7) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 6-bromo-4,4-dimethyl-2,3-dihydrochromene. InChIKey: DVVHFVGZHIQVNN-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 6-bromo-4,4-dimethyl-2,3-dihydrochromene |
| InChIKey | DVVHFVGZHIQVNN-UHFFFAOYSA-N |
| SMILES | CC1(CCOC2=C1C=C(C=C2)Br)C |
Computed by PubChem (NCBI)