Products 1027971-34-1
CAS 1027971-34-1 appears in our catalog under these names: SB–429201, SB-429201, 98.15%, SB-429201, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 100 mg, 10mM/1mL, 5 mg, 25 mg, 50 mg.
N-(4-phenoxyphenyl)-4-(3-phenylpropanoylamino)benzamide (CAS 1027971-34-1) is a chemical compound with the molecular formula C28H24N2O3 and a molecular weight of 436.5 g/mol. IUPAC name: N-(4-phenoxyphenyl)-4-(3-phenylpropanoylamino)benzamide. InChIKey: YPXLCXVERGDWHW-UHFFFAOYSA-N.
| Molecular formula | C28H24N2O3 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | N-(4-phenoxyphenyl)-4-(3-phenylpropanoylamino)benzamide |
| InChIKey | YPXLCXVERGDWHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)NC2=CC=C(C=C2)C(=O)NC3=CC=C(C=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)