Products 1338574-83-6
CAS 1338574-83-6 appears in our catalog under these names: WWL 123, WWL123, 98.0%, WWL123, ≥98%(HPLC). Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 50mg, 25mg, 100mg, 10 mg, 25 mg, 5 mg, 5mg, 10mg.
[4-(4-carbamoylphenyl)phenyl] N-methyl-N-[(3-phenylphenyl)methyl]carbamate (CAS 1338574-83-6) is a chemical compound with the molecular formula C28H24N2O3 and a molecular weight of 436.5 g/mol. IUPAC name: [4-(4-carbamoylphenyl)phenyl] N-methyl-N-[(3-phenylphenyl)methyl]carbamate. InChIKey: UUJGYRHAOHORFC-UHFFFAOYSA-N.
| Molecular formula | C28H24N2O3 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | [4-(4-carbamoylphenyl)phenyl] N-methyl-N-[(3-phenylphenyl)methyl]carbamate |
| InChIKey | UUJGYRHAOHORFC-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=CC=C1)C2=CC=CC=C2)C(=O)OC3=CC=C(C=C3)C4=CC=C(C=C4)C(=O)N |
Computed by PubChem (NCBI)