CAS 102818-95-1 is the registry number for (S)-2-Amino-4-(benzo[d]thiazol-2-ylthio)butanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-2-(1,3-benzothiazol-2-yl)-4-sulfanylbutanoic acid (CAS 102818-95-1) is a chemical compound with the molecular formula C11H12N2O2S2 and a molecular weight of 268.4 g/mol. IUPAC name: (2S)-2-amino-2-(1,3-benzothiazol-2-yl)-4-sulfanylbutanoic acid. InChIKey: GSQLXSCBEBRMII-LLVKDONJSA-N.
| Molecular formula | C11H12N2O2S2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (2S)-2-amino-2-(1,3-benzothiazol-2-yl)-4-sulfanylbutanoic acid |
| InChIKey | GSQLXSCBEBRMII-LLVKDONJSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)[C@](CCS)(C(=O)O)N |
Computed by PubChem (NCBI)