CAS 2921859-62-1 is the registry number for 5-(methylthio)-1-tosyl-1H-pyrazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-methylphenyl)sulfonyl-5-methylsulfanylpyrazole (CAS 2921859-62-1) is a chemical compound with the molecular formula C11H12N2O2S2 and a molecular weight of 268.4 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-5-methylsulfanylpyrazole. InChIKey: VPRMVGREDNJADU-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-5-methylsulfanylpyrazole |
| InChIKey | VPRMVGREDNJADU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C(=CC=N2)SC |
Computed by PubChem (NCBI)