CAS 1028203-97-5 appears in our catalog under these names: 3-Hydroxy-4-methoxycinnamic Acid-d3 (Isoferulic Acid-d3), trans-Isoferulic acid-d3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg, 100 mg, 10 mg.
(E)-3-[3-hydroxy-4-(trideuteriomethoxy)phenyl]prop-2-enoic acid (CAS 1028203-97-5) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 197.20 g/mol. IUPAC name: (E)-3-[3-hydroxy-4-(trideuteriomethoxy)phenyl]prop-2-enoic acid. InChIKey: QURCVMIEKCOAJU-CGLOQUBRSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 197.20 g/mol |
| IUPAC name | (E)-3-[3-hydroxy-4-(trideuteriomethoxy)phenyl]prop-2-enoic acid |
| InChIKey | QURCVMIEKCOAJU-CGLOQUBRSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)