Products 1028320-34-4
CAS 1028320-34-4 is the registry number for 9-Azadispiro[2.1.2.3]decane-9-carboxylic acid, 4-oxo-, 1,1-dimethylethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 4-oxo-9-azadispiro[2.1.25.33]decane-9-carboxylate (CAS 1028320-34-4) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl 4-oxo-9-azadispiro[2.1.25.33]decane-9-carboxylate. InChIKey: RSOXVBNWRSTZPL-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl 4-oxo-9-azadispiro[2.1.25.33]decane-9-carboxylate |
| InChIKey | RSOXVBNWRSTZPL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)C(=O)C3(C1)CC3 |
Computed by PubChem (NCBI)