CAS 10286-87-0 is the registry number for 2-Chloro-5-methyl-N-phenylbenzamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
N-(2-chloro-5-methylphenyl)benzamide (CAS 10286-87-0) is a chemical compound with the molecular formula C14H12ClNO and a molecular weight of 245.70 g/mol. IUPAC name: N-(2-chloro-5-methylphenyl)benzamide. InChIKey: GMBRRDISFVFICJ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | N-(2-chloro-5-methylphenyl)benzamide |
| InChIKey | GMBRRDISFVFICJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)