CAS 102878-76-2 appears in our catalog under these names: 4–Ethyl–2–methyl–1–nitrobenzene, 4-Ethyl-2-methyl-1-nitrobenzene, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 25g, 5g.
4-ethyl-2-methyl-1-nitrobenzene (CAS 102878-76-2) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 4-ethyl-2-methyl-1-nitrobenzene. InChIKey: JRFWREBLPZKNNR-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 4-ethyl-2-methyl-1-nitrobenzene |
| InChIKey | JRFWREBLPZKNNR-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)