CAS 1029-94-3 appears in our catalog under these names: 2,6–diphenyl–4H–pyran–4–one, 2,6-Diphenyl-4H-pyran-4-one 98%, 2,6-diphenyl-4H-pyran-4-one, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g.
2,6-diphenylpyran-4-one (CAS 1029-94-3) is a chemical compound with the molecular formula C17H12O2 and a molecular weight of 248.27 g/mol. IUPAC name: 2,6-diphenylpyran-4-one. InChIKey: UWCKXOXEYVSRSD-UHFFFAOYSA-N.
| Molecular formula | C17H12O2 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 2,6-diphenylpyran-4-one |
| InChIKey | UWCKXOXEYVSRSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C=C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)