CAS 93-44-7 appears in our catalog under these names: 2–Naphthyl Benzoate, 2-Naphthyl Benzoate, 2-Naphthyl Benzoate, >98.0%(GC), 2-Naphthyl benzoate 97%, 2-Naphthyl benzoate, 97%, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 250g, 500g, 25g, 1x1000mg.
Naphthalen-2-yl benzoate (CAS 93-44-7) is a chemical compound with the molecular formula C17H12O2 and a molecular weight of 248.27 g/mol. IUPAC name: naphthalen-2-yl benzoate. InChIKey: DWJIJRSTYFPKGD-UHFFFAOYSA-N.
| Molecular formula | C17H12O2 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | naphthalen-2-yl benzoate |
| InChIKey | DWJIJRSTYFPKGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)