CAS 1029439-56-2 appears in our catalog under these names: 4-(N-Phenylaminomethyl)phenylboronic acid, pinacol ester, 98%, 98%, N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)aniline, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 250mg, 1g, 5g, 25g.
N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline (CAS 1029439-56-2) is a chemical compound with the molecular formula C19H24BNO2 and a molecular weight of 309.2 g/mol. IUPAC name: N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline. InChIKey: KNYGNGFJIPTYBJ-UHFFFAOYSA-N.
| Molecular formula | C19H24BNO2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline |
| InChIKey | KNYGNGFJIPTYBJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CNC3=CC=CC=C3 |
Computed by PubChem (NCBI)