CAS 1073353-90-8 is the registry number for 3-((Phenylamino)methyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline (CAS 1073353-90-8) is a chemical compound with the molecular formula C19H24BNO2 and a molecular weight of 309.2 g/mol. IUPAC name: N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline. InChIKey: FMCOCBRSLHQLQR-UHFFFAOYSA-N.
| Molecular formula | C19H24BNO2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline |
| InChIKey | FMCOCBRSLHQLQR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CNC3=CC=CC=C3 |
Computed by PubChem (NCBI)