Products 1029439-60-8
CAS 1029439-60-8 appears in our catalog under these names: 4-{[methyl(phenyl)amino]methyl}phenylboronic acid, 95%, (4-((Methyl(phenyl)amino)methyl)phenyl)boronic acid, 97%, (4–((methyl(phenyl)amino)methyl)phenyl)boronic acid, (4-((methyl(phenyl)amino)methyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
[4-[(N-methylanilino)methyl]phenyl]boronic acid (CAS 1029439-60-8) is a chemical compound with the molecular formula C14H16BNO2 and a molecular weight of 241.10 g/mol. IUPAC name: [4-[(N-methylanilino)methyl]phenyl]boronic acid. InChIKey: IAWVCARLELQRDX-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO2 |
|---|---|
| Molecular weight | 241.10 g/mol |
| IUPAC name | [4-[(N-methylanilino)methyl]phenyl]boronic acid |
| InChIKey | IAWVCARLELQRDX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN(C)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)