Products 1334226-27-5
CAS 1334226-27-5 appears in our catalog under these names: 3-{[methyl(phenyl)amino]methyl}phenylboronic acid, 95%, (3-((Methyl(phenyl)amino)methyl)phenyl)boronic acid, 98%, (3–((Methyl(phenyl)amino)methyl)phenyl)boronic acid, Boronic acid, B-[3-[(methylphenylamino)methyl]phenyl]-, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 5g, 1g.
[3-[(N-methylanilino)methyl]phenyl]boronic acid (CAS 1334226-27-5) is a chemical compound with the molecular formula C14H16BNO2 and a molecular weight of 241.10 g/mol. IUPAC name: [3-[(N-methylanilino)methyl]phenyl]boronic acid. InChIKey: ZJQLMGRDWCNSQU-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO2 |
|---|---|
| Molecular weight | 241.10 g/mol |
| IUPAC name | [3-[(N-methylanilino)methyl]phenyl]boronic acid |
| InChIKey | ZJQLMGRDWCNSQU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN(C)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)