CAS 1029714-84-8 is the registry number for 6–(4–Bromo–3–fluorophenyl)–1,2,4–triazin–3–amine. Offered by: GLPBio. Available pack sizes: 1g, 5g.
6-(4-bromo-3-fluorophenyl)-1,2,4-triazin-3-amine (CAS 1029714-84-8) is a chemical compound with the molecular formula C9H6BrFN4 and a molecular weight of 269.07 g/mol. IUPAC name: 6-(4-bromo-3-fluorophenyl)-1,2,4-triazin-3-amine. InChIKey: SSJJUCPZNBJWOS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN4 |
|---|---|
| Molecular weight | 269.07 g/mol |
| IUPAC name | 6-(4-bromo-3-fluorophenyl)-1,2,4-triazin-3-amine |
| InChIKey | SSJJUCPZNBJWOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CN=C(N=N2)N)F)Br |
Computed by PubChem (NCBI)