CAS 1321517-59-2 appears in our catalog under these names: 6-Bromo-5-(4-fluorophenyl)-1,2,4-triazin-3-amine, 95%, 95%, 6-Bromo-5-(4-fluorophenyl)-1,2,4-triazin-3-amine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-5-(4-fluorophenyl)-1,2,4-triazin-3-amine (CAS 1321517-59-2) is a chemical compound with the molecular formula C9H6BrFN4 and a molecular weight of 269.07 g/mol. IUPAC name: 6-bromo-5-(4-fluorophenyl)-1,2,4-triazin-3-amine. InChIKey: MCPCKCYTZUJYKK-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN4 |
|---|---|
| Molecular weight | 269.07 g/mol |
| IUPAC name | 6-bromo-5-(4-fluorophenyl)-1,2,4-triazin-3-amine |
| InChIKey | MCPCKCYTZUJYKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=NC(=N2)N)Br)F |
Computed by PubChem (NCBI)