Products 1029718-68-0
CAS 1029718-68-0 appears in our catalog under these names: 5-Chloro-3-(3-fluorobenzyl)-1,2,4-thiadiazole, 95%, 5-Chloro-3-(3-fluorobenzyl)-1,2,4-thiadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 250mg, 1g.
5-chloro-3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazole (CAS 1029718-68-0) is a chemical compound with the molecular formula C9H6ClFN2S and a molecular weight of 228.67 g/mol. IUPAC name: 5-chloro-3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazole. InChIKey: DOXHLJICKRGFIT-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2S |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 5-chloro-3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazole |
| InChIKey | DOXHLJICKRGFIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC2=NSC(=N2)Cl |
Computed by PubChem (NCBI)