CAS 145029-83-0 appears in our catalog under these names: 4-(3-Chloro-4-fluorophenyl)-1,3-thiazol-2-amine, 4-(3-Chloro-4-fluorophenyl)thiazol-2-ylamine. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg.
4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-amine (CAS 145029-83-0) is a chemical compound with the molecular formula C9H6ClFN2S and a molecular weight of 228.67 g/mol. IUPAC name: 4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-amine. InChIKey: LOILNLAYTYETKO-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2S |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-amine |
| InChIKey | LOILNLAYTYETKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CSC(=N2)N)Cl)F |
Computed by PubChem (NCBI)