CAS 1030103-68-4 is the registry number for 4-(5-Amino-1,3,4-oxadiazol-2-yl)-1-phenylpyrrolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
4-(5-amino-1,3,4-oxadiazol-2-yl)-1-phenylpyrrolidin-2-one (CAS 1030103-68-4) is a chemical compound with the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. IUPAC name: 4-(5-amino-1,3,4-oxadiazol-2-yl)-1-phenylpyrrolidin-2-one. InChIKey: SPHFRCNQQCHGFF-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O2 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 4-(5-amino-1,3,4-oxadiazol-2-yl)-1-phenylpyrrolidin-2-one |
| InChIKey | SPHFRCNQQCHGFF-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=CC=C2)C3=NN=C(O3)N |
Computed by PubChem (NCBI)