Products 936643-76-4
CAS 936643-76-4 appears in our catalog under these names: 3–Pyrimidin–2–yl–2–pyrimidin–2–ylmethyl–Propionic Acid, 3-Pyrimidin-2-yl-2-pyrimidin-2-ylmethyl-propionic acid. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1g, 100mg, 500mg, Get quote.
3-pyrimidin-2-yl-2-(pyrimidin-2-ylmethyl)propanoic acid (CAS 936643-76-4) is a chemical compound with the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. IUPAC name: 3-pyrimidin-2-yl-2-(pyrimidin-2-ylmethyl)propanoic acid. InChIKey: MXSGIVAJXIIMDJ-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O2 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 3-pyrimidin-2-yl-2-(pyrimidin-2-ylmethyl)propanoic acid |
| InChIKey | MXSGIVAJXIIMDJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)CC(CC2=NC=CC=N2)C(=O)O |
Computed by PubChem (NCBI)