CAS 103031-30-7 appears in our catalog under these names: 5,5,8,8-tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarboxylic acid, 96%, 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarboxylic acid, 97% , 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid, 98%, 98%, 5,5,8,8-tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarboxylic acid, 98%, 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid, 98%. Offered by: Combi-blocks, Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 250MG, 100mg.
5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylic acid (CAS 103031-30-7) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylic acid. InChIKey: KSEZYZSBKCPEKP-UHFFFAOYSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylic acid |
| InChIKey | KSEZYZSBKCPEKP-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)C(=O)O)(C)C)C |
Computed by PubChem (NCBI)