Products 113283-35-5
CAS 113283-35-5 is the registry number for 6-Hydroxy-2-methyl-6-p-tolylhept-2-en-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-hydroxy-2-methyl-6-(4-methylphenyl)hept-2-en-4-one (CAS 113283-35-5) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: 6-hydroxy-2-methyl-6-(4-methylphenyl)hept-2-en-4-one. InChIKey: HFXMOIIGXSNZTK-UHFFFAOYSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | 6-hydroxy-2-methyl-6-(4-methylphenyl)hept-2-en-4-one |
| InChIKey | HFXMOIIGXSNZTK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C)(CC(=O)C=C(C)C)O |
Computed by PubChem (NCBI)