CAS 1030390-38-5 appears in our catalog under these names: (1R,2R)-1,2-Cyclopentanediamine dihydrochloride, 98%, (1R,2R)-Cyclopentane-1,2-diamine dihydrochloride, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride (CAS 1030390-38-5) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride. InChIKey: VZCLGIZICFQJBX-ALUAXPQUSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride |
| InChIKey | VZCLGIZICFQJBX-ALUAXPQUSA-N |
| SMILES | C1C[C@H]([C@@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)