CAS 1030422-61-7 is the registry number for 3,4-Dihydro-2h-thieno[2,3-e][1,2]thiazin-4-ol 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1,1-dioxo-3,4-dihydro-2H-thieno[2,3-e]thiazin-4-ol (CAS 1030422-61-7) is a chemical compound with the molecular formula C6H7NO3S2 and a molecular weight of 205.3 g/mol. IUPAC name: 1,1-dioxo-3,4-dihydro-2H-thieno[2,3-e]thiazin-4-ol. InChIKey: KEPIKQKCKNDGKJ-UHFFFAOYSA-N.
| Molecular formula | C6H7NO3S2 |
|---|---|
| Molecular weight | 205.3 g/mol |
| IUPAC name | 1,1-dioxo-3,4-dihydro-2H-thieno[2,3-e]thiazin-4-ol |
| InChIKey | KEPIKQKCKNDGKJ-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(C=CS2)S(=O)(=O)N1)O |
Computed by PubChem (NCBI)