Products 878477-22-6

CAS 878477-22-6 is the registry number for 3-Hydroxy-5-methylsulfanyl-isothiazole-4-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-methylsulfanyl-3-oxo-1,2-thiazole-4-carboxylate (CAS 878477-22-6) is a chemical compound with the molecular formula C6H7NO3S2 and a molecular weight of 205.3 g/mol. IUPAC name: methyl 5-methylsulfanyl-3-oxo-1,2-thiazole-4-carboxylate. InChIKey: LELGRSWICDCODU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO3S2
Molecular weight205.3 g/mol
IUPAC namemethyl 5-methylsulfanyl-3-oxo-1,2-thiazole-4-carboxylate
InChIKeyLELGRSWICDCODU-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(SNC1=O)SC

Computed by PubChem (NCBI)