CAS 103059-96-7 is the registry number for Clavamycin E. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-aminopropanoylamino)-3-hydroxy-3-(7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl)propanoic acid (CAS 103059-96-7) is a chemical compound with the molecular formula C11H17N3O6 and a molecular weight of 287.27 g/mol. IUPAC name: 2-(2-aminopropanoylamino)-3-hydroxy-3-(7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl)propanoic acid. InChIKey: HYVUCUGHACXFFU-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O6 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 2-(2-aminopropanoylamino)-3-hydroxy-3-(7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-yl)propanoic acid |
| InChIKey | HYVUCUGHACXFFU-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC(C(C1CN2C(O1)CC2=O)O)C(=O)O)N |
Computed by PubChem (NCBI)