CAS 72667-55-1 is the registry number for 5-((Methylamino)methyl)uridine. Offered by: Biosynth. Available pack sizes: 2g, 1g.
5-methylaminomethyluridine is a derivative of uridine, bearing an additional methylaminomethyl substituent at position 5 on the uracil ring.
Source: ChEBI
| Molecular formula | C11H17N3O6 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(methylaminomethyl)pyrimidine-2,4-dione |
| InChIKey | ZXQHKBUIXRFZBV-FDDDBJFASA-N |
| SMILES | CNCC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)