CAS 103068-13-9 is the registry number for 2,2'',4,4'',6,6''-Hexamethyl-1,1':3',1''-terphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
1,3,5-trimethyl-2-[3-(2,4,6-trimethylphenyl)phenyl]benzene (CAS 103068-13-9) is a chemical compound with the molecular formula C24H26 and a molecular weight of 314.5 g/mol. IUPAC name: 1,3,5-trimethyl-2-[3-(2,4,6-trimethylphenyl)phenyl]benzene. InChIKey: BLMNYBILXVYPSL-UHFFFAOYSA-N.
| Molecular formula | C24H26 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | 1,3,5-trimethyl-2-[3-(2,4,6-trimethylphenyl)phenyl]benzene |
| InChIKey | BLMNYBILXVYPSL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=CC(=CC=C2)C3=C(C=C(C=C3C)C)C)C |
Computed by PubChem (NCBI)