CAS 24300-91-2 appears in our catalog under these names: 2,7–Di–tert–butylpyrene, 2,7-Di-tert-butylpyrene, >98.0%(GC), 2,7-Di-tert-butylpyrene 97%, 2,7-Di-tert-butylpyrene, 97%, 97%, 2,7-Di-tert-butylpyrene, 96%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 500g, 10g, 100g, 250mg, 50g.
2,7-ditert-butylpyrene (CAS 24300-91-2) is a chemical compound with the molecular formula C24H26 and a molecular weight of 314.5 g/mol. IUPAC name: 2,7-ditert-butylpyrene. InChIKey: SKZSSCAGJZEXEA-UHFFFAOYSA-N.
| Molecular formula | C24H26 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | 2,7-ditert-butylpyrene |
| InChIKey | SKZSSCAGJZEXEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C3C(=C1)C=CC4=CC(=CC(=C43)C=C2)C(C)(C)C |
Computed by PubChem (NCBI)