Products 1030694-79-1
CAS 1030694-79-1 is the registry number for 2-Fluoro-5-((3-fluorophenyl)sulfamoyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-fluoro-5-[(3-fluorophenyl)sulfamoyl]benzoic acid (CAS 1030694-79-1) is a chemical compound with the molecular formula C13H9F2NO4S and a molecular weight of 313.28 g/mol. IUPAC name: 2-fluoro-5-[(3-fluorophenyl)sulfamoyl]benzoic acid. InChIKey: YTEAVWREHIDQRX-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO4S |
|---|---|
| Molecular weight | 313.28 g/mol |
| IUPAC name | 2-fluoro-5-[(3-fluorophenyl)sulfamoyl]benzoic acid |
| InChIKey | YTEAVWREHIDQRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)NS(=O)(=O)C2=CC(=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)