CAS 329908-54-5 appears in our catalog under these names: 2-(3,4-Difluoro-benzenesulfonylamino)-benzoic acid, 95%, 2-(3,4-Difluorobenzenesulfonamido)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(3,4-difluorophenyl)sulfonylamino]benzoic acid (CAS 329908-54-5) is a chemical compound with the molecular formula C13H9F2NO4S and a molecular weight of 313.28 g/mol. IUPAC name: 2-[(3,4-difluorophenyl)sulfonylamino]benzoic acid. InChIKey: KRYRINOVIRXGEB-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO4S |
|---|---|
| Molecular weight | 313.28 g/mol |
| IUPAC name | 2-[(3,4-difluorophenyl)sulfonylamino]benzoic acid |
| InChIKey | KRYRINOVIRXGEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)