CAS 1030829-65-2 appears in our catalog under these names: 1-(3-Chloro-2-fluorophenyl)biguanide hydrochloride, 95%, 1-(3-Chloro-2-fluorophenyl)biguanide hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
2-(3-chloro-2-fluorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride (CAS 1030829-65-2) is a chemical compound with the molecular formula C8H10Cl2FN5 and a molecular weight of 266.10 g/mol. IUPAC name: 2-(3-chloro-2-fluorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride. InChIKey: HEXFLOGYOUDMNQ-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2FN5 |
|---|---|
| Molecular weight | 266.10 g/mol |
| IUPAC name | 2-(3-chloro-2-fluorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride |
| InChIKey | HEXFLOGYOUDMNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)N=C(N)N=C(N)N.Cl |
Computed by PubChem (NCBI)